C29H39N5O4Si — CID 71602262
2-[[(3R)-3-acetamido-2,3-dihydro-1H-inden-5-yl]oxy]-N-[(1R)-1-cyclopropylethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71602262) has the molecular formula C29H39N5O4Si and a molecular weight of 549.75 g/mol. Its IUPAC name is 2-[[(3R)-3-acetamido-2,3-dihydro-1H-inden-5-yl]oxy]-N-[(1R)-1-cyclopropylethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[[(3R)-3-acetamido-2,3-dihydro-1H-inden-5-yl]oxy]-N-[(1R)-1-cyclopropylethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71602262 |
| Molecular Formula | C29H39N5O4Si |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 2-[[(3R)-3-acetamido-2,3-dihydro-1H-inden-5-yl]oxy]-N-[(1R)-1-cyclopropylethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCc2ccc(Oc3cnc4c(n3)c(C(=O)N[C@H](C)C3CC3)cn4COCC[Si](C)(C)C)cc21 |
| InChI | InChI=1S/C29H39N5O4Si/c1-18(20-6-7-20)31-29(36)24-16-34(17-37-12-13-39(3,4)5)28-27(24)33-26(15-30-28)38-22-10-8-21-9-11-25(23(21)14-22)32-19(2)35/h8,10,14-16,18,20,25H,6-7,9,11-13,17H2,1-5H3,(H,31,36)(H,32,35)/t18-,25-/m1/s1 |
| InChIKey | GXBOOJCPBSPVQI-IQGLISFBSA-N |
| XLogP | 5.19 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|