C19H23F2N3O2S — CID 71602371
N-(2,4-difluorophenyl)-3,3-diethyl-1,2,4,5-tetrahydro-1,4-benzodiazepine-7-sulfonamide (PubChem CID 71602371) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3,3-diethyl-1,2,4,5-tetrahydro-1,4-benzodiazepine-7-sulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-3,3-diethyl-1,2,4,5-tetrahydro-1,4-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 71602371 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(2,4-difluorophenyl)-3,3-diethyl-1,2,4,5-tetrahydro-1,4-benzodiazepine-7-sulfonamide |
| SMILES | CCC1(CC)CNc2ccc(S(=O)(=O)Nc3ccc(F)cc3F)cc2CN1 |
| InChI | InChI=1S/C19H23F2N3O2S/c1-3-19(4-2)12-22-17-8-6-15(9-13(17)11-23-19)27(25,26)24-18-7-5-14(20)10-16(18)21/h5-10,22-24H,3-4,11-12H2,1-2H3 |
| InChIKey | WEMQWCPJHBGZMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |