C28H29Cl2N5 — CID 71602590
(1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-phenylbutyl)ethane-1,2-diamine (PubChem CID 71602590) has the molecular formula C28H29Cl2N5 and a molecular weight of 506.48 g/mol. Its IUPAC name is (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-phenylbutyl)ethane-1,2-diamine.
| Compound Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-phenylbutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71602590 |
| Molecular Formula | C28H29Cl2N5 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-phenylbutyl)ethane-1,2-diamine |
| SMILES | Cc1nc(-c2ccc(Cl)cn2)nc(NC[C@H](NCCCCc2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C28H29Cl2N5/c1-20-26(30)28(35-27(34-20)24-16-15-23(29)18-32-24)33-19-25(22-13-6-3-7-14-22)31-17-9-8-12-21-10-4-2-5-11-21/h2-7,10-11,13-16,18,25,31H,8-9,12,17,19H2,1H3,(H,33,34,35)/t25-/m0/s1 |
| InChIKey | UZZVALJVPJZKDU-VWLOTQADSA-N |
| XLogP | 6.92 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|