C26H27Cl2N5O — CID 71602649
(1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-N-[4-(furan-2-yl)butyl]-1-phenylethane-1,2-diamine (PubChem CID 71602649) has the molecular formula C26H27Cl2N5O and a molecular weight of 496.44 g/mol. Its IUPAC name is (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-N-[4-(furan-2-yl)butyl]-1-phenylethane-1,2-diamine.
| Compound Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-N-[4-(furan-2-yl)butyl]-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 71602649 |
| Molecular Formula | C26H27Cl2N5O |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-N-[4-(furan-2-yl)butyl]-1-phenylethane-1,2-diamine |
| SMILES | Cc1nc(-c2ccc(Cl)cn2)nc(NC[C@H](NCCCCc2ccco2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C26H27Cl2N5O/c1-18-24(28)26(33-25(32-18)22-13-12-20(27)16-30-22)31-17-23(19-8-3-2-4-9-19)29-14-6-5-10-21-11-7-15-34-21/h2-4,7-9,11-13,15-16,23,29H,5-6,10,14,17H2,1H3,(H,31,32,33)/t23-/m0/s1 |
| InChIKey | LKZOEGULSZHBLG-QHCPKHFHSA-N |
| XLogP | 6.51 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|