C21H25ClN6O3S2 — CID 71602685
N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(4-sulfamoylphenyl)methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride (PubChem CID 71602685) has the molecular formula C21H25ClN6O3S2 and a molecular weight of 509.06 g/mol. Its IUPAC name is N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(4-sulfamoylphenyl)methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride.
| Compound Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(4-sulfamoylphenyl)methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 71602685 |
| Molecular Formula | C21H25ClN6O3S2 |
| Molecular Weight | 509.06 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[(4-sulfamoylphenyl)methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(Cc2ccc(S(N)(=O)=O)cc2)s1.Cl |
| InChI | InChI=1S/C21H24N6O3S2.ClH/c1-13(28)25-21-27-18(11-6-14-2-7-16(8-3-14)26-20(22)23)19(31-21)12-15-4-9-17(10-5-15)32(24,29)30;/h2-5,7-10H,6,11-12H2,1H3,(H4,22,23,26)(H2,24,29,30)(H,25,27,28);1H |
| InChIKey | SWROQLKQUYQHOP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.06 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|