C23H29ClN6O3S2 — CID 71602686
N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[[4-(dimethylsulfamoyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride (PubChem CID 71602686) has the molecular formula C23H29ClN6O3S2 and a molecular weight of 537.11 g/mol. Its IUPAC name is N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[[4-(dimethylsulfamoyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride.
| Compound Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[[4-(dimethylsulfamoyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 71602686 |
| Molecular Formula | C23H29ClN6O3S2 |
| Molecular Weight | 537.11 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-[[4-(dimethylsulfamoyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(Cc2ccc(S(=O)(=O)N(C)C)cc2)s1.Cl |
| InChI | InChI=1S/C23H28N6O3S2.ClH/c1-15(30)26-23-28-20(13-8-16-4-9-18(10-5-16)27-22(24)25)21(33-23)14-17-6-11-19(12-7-17)34(31,32)29(2)3;/h4-7,9-12H,8,13-14H2,1-3H3,(H4,24,25,27)(H,26,28,30);1H |
| InChIKey | YUPZGEYJHYOBRQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|