C31H30Cl2N6 — CID 71602694
(1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-quinolin-2-ylbutyl)ethane-1,2-diamine (PubChem CID 71602694) has the molecular formula C31H30Cl2N6 and a molecular weight of 557.53 g/mol. Its IUPAC name is (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-quinolin-2-ylbutyl)ethane-1,2-diamine.
| Compound Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-quinolin-2-ylbutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71602694 |
| Molecular Formula | C31H30Cl2N6 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | (1R)-N'-[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]-1-phenyl-N-(4-quinolin-2-ylbutyl)ethane-1,2-diamine |
| SMILES | Cc1nc(-c2ccc(Cl)cn2)nc(NC[C@H](NCCCCc2ccc3ccccc3n2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C31H30Cl2N6/c1-21-29(33)31(39-30(37-21)27-17-15-24(32)19-35-27)36-20-28(22-9-3-2-4-10-22)34-18-8-7-12-25-16-14-23-11-5-6-13-26(23)38-25/h2-6,9-11,13-17,19,28,34H,7-8,12,18,20H2,1H3,(H,36,37,39)/t28-/m0/s1 |
| InChIKey | QSHFFYGHXXOIKZ-NDEPHWFRSA-N |
| XLogP | 7.47 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|