C18H26BrN3O2 — CID 71602887
N'-(3-bromo-4-methylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 71602887) has the molecular formula C18H26BrN3O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is N'-(3-bromo-4-methylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(3-bromo-4-methylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 71602887 |
| Molecular Formula | C18H26BrN3O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N'-(3-bromo-4-methylphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1Br |
| InChI | InChI=1S/C18H26BrN3O2/c1-11-6-7-12(8-14(11)19)20-15(23)16(24)21-13-9-17(2,3)22-18(4,5)10-13/h6-8,13,22H,9-10H2,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | BLKGRYMBTHUOLC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|