About [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea
[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea (PubChem CID 71602930) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea |
| PubChem CID | 71602930 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea |
| SMILES | COc1ccc2c(c1)/C(=N/NC(N)=S)CCC2 |
| InChI | InChI=1S/C12H15N3OS/c1-16-9-6-5-8-3-2-4-11(10(8)7-9)14-15-12(13)17/h5-7H,2-4H2,1H3,(H3,13,15,17)/b14-11+ |
| InChIKey | NGIIRWGCDGUKFT-SDNWHVSQSA-N |
| XLogP | 1.57 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea?
The IUPAC name of [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea (CID 71602930) is [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea.
What is the SMILES notation for [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea?
The canonical SMILES for [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea is COc1ccc2c(c1)/C(=N/NC(N)=S)CCC2.
What is the InChIKey of [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea?
The InChIKey is NGIIRWGCDGUKFT-SDNWHVSQSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-16-9-6-5-8-3-2-4-11(10(8)7-9)14-15-12(13)17/h5-7H,2-4H2,1H3,(H3,13,15,17)/b14-11+.
What are the key properties of [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea?
[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea has a molecular weight of 249.34 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]thiourea is sourced from PubChem (CID 71602930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).