About 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea
1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 71603058) has the molecular formula C15H21N3OS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 71603058 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NC2C3CC4CC(C3)CC2C4)n1 |
| InChI | InChI=1S/C15H21N3OS/c1-8-7-20-15(16-8)18-14(19)17-13-11-3-9-2-10(5-11)6-12(13)4-9/h7,9-13H,2-6H2,1H3,(H2,16,17,18,19) |
| InChIKey | BZWAQJJUJUGDCR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea (CID 71603058) is 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea is Cc1csc(NC(=O)NC2C3CC4CC(C3)CC2C4)n1.
What is the InChIKey of 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea?
The InChIKey is BZWAQJJUJUGDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS/c1-8-7-20-15(16-8)18-14(19)17-13-11-3-9-2-10(5-11)6-12(13)4-9/h7,9-13H,2-6H2,1H3,(H2,16,17,18,19).
What are the key properties of 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea?
1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea has a molecular weight of 291.42 g/mol, XLogP of 3.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-3-(4-methyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 71603058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).