C32H53NO3SSi2 — CID 71603285
2-(4-methylphenyl)sulfonyl-4,6-bis[tri(propan-2-yl)silyl]-1,3-dihydrocyclopenta[c]pyrrol-5-one (PubChem CID 71603285) has the molecular formula C32H53NO3SSi2 and a molecular weight of 588.02 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4,6-bis[tri(propan-2-yl)silyl]-1,3-dihydrocyclopenta[c]pyrrol-5-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4,6-bis[tri(propan-2-yl)silyl]-1,3-dihydrocyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 71603285 |
| Molecular Formula | C32H53NO3SSi2 |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4,6-bis[tri(propan-2-yl)silyl]-1,3-dihydrocyclopenta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C([Si](C(C)C)(C(C)C)C(C)C)C(=O)C([Si](C(C)C)(C(C)C)C(C)C)=C3C2)cc1 |
| InChI | InChI=1S/C32H53NO3SSi2/c1-20(2)38(21(3)4,22(5)6)31-28-18-33(37(35,36)27-16-14-26(13)15-17-27)19-29(28)32(30(31)34)39(23(7)8,24(9)10)25(11)12/h14-17,20-25H,18-19H2,1-13H3 |
| InChIKey | YEMVASMBTWMHRT-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|