About 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one
2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one (PubChem CID 71603287) has the molecular formula C20H29NO3SSi2
and a molecular weight of 419.70 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one |
| PubChem CID | 71603287 |
| Molecular Formula | C20H29NO3SSi2 |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C3C2)cc1 |
| InChI | InChI=1S/C20H29NO3SSi2/c1-14-8-10-15(11-9-14)25(23,24)21-12-16-17(13-21)20(27(5,6)7)18(22)19(16)26(2,3)4/h8-11H,12-13H2,1-7H3 |
| InChIKey | ZGZKFBHGNROYBP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one?
The IUPAC name of 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one (CID 71603287) is 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one.
What is the SMILES notation for 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one?
The canonical SMILES for 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one is Cc1ccc(S(=O)(=O)N2CC3=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C3C2)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one?
The InChIKey is ZGZKFBHGNROYBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO3SSi2/c1-14-8-10-15(11-9-14)25(23,24)21-12-16-17(13-21)20(27(5,6)7)18(22)19(16)26(2,3)4/h8-11H,12-13H2,1-7H3.
What are the key properties of 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one?
2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one has a molecular weight of 419.70 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-1,3-dihydrocyclopenta[c]pyrrol-5-one is sourced from PubChem (CID 71603287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).