C26H30ClN3O5 — CID 71603299
N'-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetohydrazide (PubChem CID 71603299) has the molecular formula C26H30ClN3O5 and a molecular weight of 500.00 g/mol. Its IUPAC name is N'-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetohydrazide.
| Compound Name | N'-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetohydrazide |
|---|---|
| PubChem CID | 71603299 |
| Molecular Formula | C26H30ClN3O5 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N'-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetohydrazide |
| SMILES | CC(=O)NNC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H30ClN3O5/c1-14(31)29-28-12-21-23(32)24(33)25(34)26(35-21)30-13-18(22-19(27)3-2-4-20(22)30)11-15-5-7-16(8-6-15)17-9-10-17/h2-8,13,17,21,23-26,28,32-34H,9-12H2,1H3,(H,29,31)/t21-,23-,24+,25-,26-/m1/s1 |
| InChIKey | IRVUXRGMYXKVHJ-XDXGNBCUSA-N |
| XLogP | 2.38 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|