C28H31ClN2O7 — CID 71603300
methyl 3-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-3-oxopropanoate (PubChem CID 71603300) has the molecular formula C28H31ClN2O7 and a molecular weight of 543.02 g/mol. Its IUPAC name is methyl 3-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-3-oxopropanoate.
| Compound Name | methyl 3-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 71603300 |
| Molecular Formula | C28H31ClN2O7 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | methyl 3-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)NC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H31ClN2O7/c1-37-23(33)12-22(32)30-13-21-25(34)26(35)27(36)28(38-21)31-14-18(24-19(29)3-2-4-20(24)31)11-15-5-7-16(8-6-15)17-9-10-17/h2-8,14,17,21,25-28,34-36H,9-13H2,1H3,(H,30,32)/t21-,25-,26+,27-,28-/m1/s1 |
| InChIKey | KBNLLFFWZMJVBR-QCCXDOPZSA-N |
| XLogP | 2.42 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|