C16H26O4 — CID 71603458
3-[(2S,5S)-4-methylidene-5-(3-oxopropyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 71603458) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[(2S,5S)-4-methylidene-5-(3-oxopropyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,5S)-4-methylidene-5-(3-oxopropyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71603458 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-[(2S,5S)-4-methylidene-5-(3-oxopropyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C1C[C@H](CCCOC(=O)C(C)(C)C)O[C@H]1CCC=O |
| InChI | InChI=1S/C16H26O4/c1-12-11-13(20-14(12)8-5-9-17)7-6-10-19-15(18)16(2,3)4/h9,13-14H,1,5-8,10-11H2,2-4H3/t13-,14-/m0/s1 |
| InChIKey | BRARPUHNVPNIOB-KBPBESRZSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|