C34H40FN7O3 — CID 71603852
1-[(1S,4R)-4-[[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-fluoro-5-morpholin-4-ylphenyl)urea (PubChem CID 71603852) has the molecular formula C34H40FN7O3 and a molecular weight of 613.74 g/mol. Its IUPAC name is 1-[(1S,4R)-4-[[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-fluoro-5-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[(1S,4R)-4-[[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-fluoro-5-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 71603852 |
| Molecular Formula | C34H40FN7O3 |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | 1-[(1S,4R)-4-[[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3-fluoro-5-morpholin-4-ylphenyl)urea |
| SMILES | C[C@@H]1CCC[C@H](C)N1c1nnc2ccc(O[C@@H]3CC[C@H](NC(=O)Nc4cc(F)cc(N5CCOCC5)c4)c4ccccc43)cn12 |
| InChI | InChI=1S/C34H40FN7O3/c1-22-6-5-7-23(2)42(22)34-39-38-32-13-10-27(21-41(32)34)45-31-12-11-30(28-8-3-4-9-29(28)31)37-33(43)36-25-18-24(35)19-26(20-25)40-14-16-44-17-15-40/h3-4,8-10,13,18-23,30-31H,5-7,11-12,14-17H2,1-2H3,(H2,36,37,43)/t22-,23+,30-,31+/m0/s1 |
| InChIKey | KPFFZUJXFIPZQF-AJMMQEIQSA-N |
| XLogP | 6.25 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |