About [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate
[4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate (PubChem CID 71604103) has the molecular formula C22H21N3O4S
and a molecular weight of 423.49 g/mol. Its IUPAC name is [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate.
Molecular Properties
| Compound Name | [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate |
| PubChem CID | 71604103 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate |
| SMILES | NCC(C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(COC(=O)c2ccsc2)cc1 |
| InChI | InChI=1S/C22H21N3O4S/c23-11-19(21(27)25-18-7-5-16(6-8-18)20(24)26)15-3-1-14(2-4-15)12-29-22(28)17-9-10-30-13-17/h1-10,13,19H,11-12,23H2,(H2,24,26)(H,25,27) |
| InChIKey | MUZDNTASDMUNKB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate?
The IUPAC name of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate (CID 71604103) is [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate.
What is the SMILES notation for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate?
The canonical SMILES for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate is NCC(C(=O)Nc1ccc(C(N)=O)cc1)c1ccc(COC(=O)c2ccsc2)cc1.
What is the InChIKey of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate?
The InChIKey is MUZDNTASDMUNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O4S/c23-11-19(21(27)25-18-7-5-16(6-8-18)20(24)26)15-3-1-14(2-4-15)12-29-22(28)17-9-10-30-13-17/h1-10,13,19H,11-12,23H2,(H2,24,26)(H,25,27).
What are the key properties of [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate?
[4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate has a molecular weight of 423.49 g/mol, XLogP of 2.88, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-amino-1-(4-carbamoylanilino)-1-oxopropan-2-yl]phenyl]methyl thiophene-3-carboxylate is sourced from PubChem (CID 71604103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).