C26H29ClN2O5 — CID 71604270
N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetamide (PubChem CID 71604270) has the molecular formula C26H29ClN2O5 and a molecular weight of 484.98 g/mol. Its IUPAC name is N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 71604270 |
| Molecular Formula | C26H29ClN2O5 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H29ClN2O5/c1-14(30)28-12-21-23(31)24(32)25(33)26(34-21)29-13-18(22-19(27)3-2-4-20(22)29)11-15-5-7-16(8-6-15)17-9-10-17/h2-8,13,17,21,23-26,31-33H,9-12H2,1H3,(H,28,30)/t21-,23-,24+,25-,26-/m1/s1 |
| InChIKey | BILGTWHYSCNCRU-XDXGNBCUSA-N |
| XLogP | 2.88 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |