C26H30ClN3O6 — CID 71604271
methyl N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]carbamate (PubChem CID 71604271) has the molecular formula C26H30ClN3O6 and a molecular weight of 515.99 g/mol. Its IUPAC name is methyl N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]carbamate.
| Compound Name | methyl N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]carbamate |
|---|---|
| PubChem CID | 71604271 |
| Molecular Formula | C26H30ClN3O6 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | methyl N-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]carbamate |
| SMILES | COC(=O)NNC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H30ClN3O6/c1-35-26(34)29-28-12-20-22(31)23(32)24(33)25(36-20)30-13-17(21-18(27)3-2-4-19(21)30)11-14-5-7-15(8-6-14)16-9-10-16/h2-8,13,16,20,22-25,28,31-33H,9-12H2,1H3,(H,29,34)/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | MJDYOKVCLBJZKG-PRDVQWLOSA-N |
| XLogP | 2.60 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|