C28H29NO4 — CID 71604416
(2S,4S)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)pyrrolidine-2-carboxylic acid (PubChem CID 71604416) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71604416 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-phenylpropoxy)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](OCCCc2ccccc2)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c30-27(26(22-14-6-2-7-15-22)23-16-8-3-9-17-23)29-20-24(19-25(29)28(31)32)33-18-10-13-21-11-4-1-5-12-21/h1-9,11-12,14-17,24-26H,10,13,18-20H2,(H,31,32)/t24-,25-/m0/s1 |
| InChIKey | OSURWJVNFXMFKH-DQEYMECFSA-N |
| XLogP | 4.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|