About 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole
1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole (PubChem CID 71604542) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole.
Molecular Properties
| Compound Name | 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole |
| PubChem CID | 71604542 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole |
| SMILES | COc1ccc(C(C)c2ccc3c(ccn3C)c2)c(OC)c1OC |
| InChI | InChI=1S/C20H23NO3/c1-13(14-6-8-17-15(12-14)10-11-21(17)2)16-7-9-18(22-3)20(24-5)19(16)23-4/h6-13H,1-5H3 |
| InChIKey | NUMYGDDLVWVHKN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole?
The IUPAC name of 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole (CID 71604542) is 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole.
What is the SMILES notation for 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole?
The canonical SMILES for 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole is COc1ccc(C(C)c2ccc3c(ccn3C)c2)c(OC)c1OC.
What is the InChIKey of 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole?
The InChIKey is NUMYGDDLVWVHKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-13(14-6-8-17-15(12-14)10-11-21(17)2)16-7-9-18(22-3)20(24-5)19(16)23-4/h6-13H,1-5H3.
What are the key properties of 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole?
1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole has a molecular weight of 325.41 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[1-(2,3,4-trimethoxyphenyl)ethyl]indole is sourced from PubChem (CID 71604542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).