C22H37N3O4 — CID 71604771
methyl 2-[(2R,6S)-2,6-bis(cyclohexylcarbamoyl)piperidin-1-yl]acetate (PubChem CID 71604771) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-2,6-bis(cyclohexylcarbamoyl)piperidin-1-yl]acetate.
| Compound Name | methyl 2-[(2R,6S)-2,6-bis(cyclohexylcarbamoyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 71604771 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | methyl 2-[(2R,6S)-2,6-bis(cyclohexylcarbamoyl)piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1[C@@H](C(=O)NC2CCCCC2)CCC[C@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H37N3O4/c1-29-20(26)15-25-18(21(27)23-16-9-4-2-5-10-16)13-8-14-19(25)22(28)24-17-11-6-3-7-12-17/h16-19H,2-15H2,1H3,(H,23,27)(H,24,28)/t18-,19+ |
| InChIKey | JJHDUBTVGGQZIW-KDURUIRLSA-N |
| XLogP | 2.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |