About [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol
[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol (PubChem CID 71604854) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol |
| PubChem CID | 71604854 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(CO)cn2C |
| InChI | InChI=1S/C21H23NO4/c1-13(15-9-19(24-3)21(26-5)20(10-15)25-4)14-6-7-18-17(8-14)16(12-23)11-22(18)2/h6-11,23H,1,12H2,2-5H3 |
| InChIKey | CDVNHTOLJXASDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol?
The IUPAC name of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol (CID 71604854) is [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol.
What is the SMILES notation for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol?
The canonical SMILES for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol is C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(CO)cn2C.
What is the InChIKey of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol?
The InChIKey is CDVNHTOLJXASDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-13(15-9-19(24-3)21(26-5)20(10-15)25-4)14-6-7-18-17(8-14)16(12-23)11-22(18)2/h6-11,23H,1,12H2,2-5H3.
What are the key properties of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol?
[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol has a molecular weight of 353.42 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methanol is sourced from PubChem (CID 71604854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).