C15H17NO3 — CID 71604947
2-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-indole (PubChem CID 71604947) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-indole.
| Compound Name | 2-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-indole |
|---|---|
| PubChem CID | 71604947 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-indole |
| SMILES | CC1(C)O[C@H]2[C@@H](c3cc4ccccc4[nH]3)OC[C@H]2O1 |
| InChI | InChI=1S/C15H17NO3/c1-15(2)18-12-8-17-13(14(12)19-15)11-7-9-5-3-4-6-10(9)16-11/h3-7,12-14,16H,8H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | LXICCHCUJGETJP-MGPQQGTHSA-N |
| XLogP | 2.76 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |