C23H26N8O2S — CID 71605190
2-[3-[[4-[2-(diaminomethylideneamino)ethylamino]-5,10-dioxonaphtho[2,3-f][1]benzothiol-11-yl]amino]propyl]guanidine (PubChem CID 71605190) has the molecular formula C23H26N8O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-[3-[[4-[2-(diaminomethylideneamino)ethylamino]-5,10-dioxonaphtho[2,3-f][1]benzothiol-11-yl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[2-(diaminomethylideneamino)ethylamino]-5,10-dioxonaphtho[2,3-f][1]benzothiol-11-yl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 71605190 |
| Molecular Formula | C23H26N8O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[3-[[4-[2-(diaminomethylideneamino)ethylamino]-5,10-dioxonaphtho[2,3-f][1]benzothiol-11-yl]amino]propyl]guanidine |
| SMILES | NC(N)=NCCCNc1c2c(c(NCCN=C(N)N)c3ccsc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H26N8O2S/c24-22(25)30-8-3-7-28-18-16-15(19(32)12-4-1-2-5-13(12)20(16)33)17(14-6-11-34-21(14)18)29-9-10-31-23(26)27/h1-2,4-6,11,28-29H,3,7-10H2,(H4,24,25,30)(H4,26,27,31) |
| InChIKey | JRTFDKHKZUSVCF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 187.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|