C30H60O3Si2 — CID 71605304
[(4R,5S,7E,9R)-9-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-5,7-dimethyldeca-1,7-dien-4-yl]oxy-triethylsilane (PubChem CID 71605304) has the molecular formula C30H60O3Si2 and a molecular weight of 524.98 g/mol. Its IUPAC name is [(4R,5S,7E,9R)-9-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-5,7-dimethyldeca-1,7-dien-4-yl]oxy-triethylsilane.
| Compound Name | [(4R,5S,7E,9R)-9-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-5,7-dimethyldeca-1,7-dien-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71605304 |
| Molecular Formula | C30H60O3Si2 |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.41 |
| IUPAC Name | [(4R,5S,7E,9R)-9-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-5,7-dimethyldeca-1,7-dien-4-yl]oxy-triethylsilane |
| SMILES | C=CC[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C/C(C)=C/[C@@H](C)[C@H]1C[C@@H](C)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C30H60O3Si2/c1-15-19-27(32-34(16-2,17-3)18-4)24(6)20-23(5)21-25(7)28-22-26(8)31-35(33-28,29(9,10)11)30(12,13)14/h15,21,24-28H,1,16-20,22H2,2-14H3/b23-21+/t24-,25+,26+,27+,28+/m0/s1 |
| InChIKey | KWIZVZLXYNMEBC-OYXAYCRNSA-N |
| XLogP | 9.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|