C18H15F3N2O2 — CID 71605341
(2R,3R,3aS)-2-hydroxy-3-phenyl-2-(trifluoromethyl)-3,3a,4,9-tetrahydropyrrolo[2,1-b]quinazolin-1-one (PubChem CID 71605341) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is (2R,3R,3aS)-2-hydroxy-3-phenyl-2-(trifluoromethyl)-3,3a,4,9-tetrahydropyrrolo[2,1-b]quinazolin-1-one.
| Compound Name | (2R,3R,3aS)-2-hydroxy-3-phenyl-2-(trifluoromethyl)-3,3a,4,9-tetrahydropyrrolo[2,1-b]quinazolin-1-one |
|---|---|
| PubChem CID | 71605341 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R,3R,3aS)-2-hydroxy-3-phenyl-2-(trifluoromethyl)-3,3a,4,9-tetrahydropyrrolo[2,1-b]quinazolin-1-one |
| SMILES | O=C1N2Cc3ccccc3N[C@@H]2[C@@H](c2ccccc2)[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O2/c19-18(20,21)17(25)14(11-6-2-1-3-7-11)15-22-13-9-5-4-8-12(13)10-23(15)16(17)24/h1-9,14-15,22,25H,10H2/t14-,15+,17-/m1/s1 |
| InChIKey | XHXBESINRABRJZ-HLLBOEOZSA-N |
| XLogP | 2.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |