About 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium
1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium (PubChem CID 71605375) has the molecular formula C28H28NO2+
and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium |
| PubChem CID | 71605375 |
| Molecular Formula | C28H28NO2+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium |
| SMILES | Cc1ccc(C#CCOCc2cccc(COCC#Cc3ccc(C)cc3)[n+]2C)cc1 |
| InChI | InChI=1S/C28H28NO2/c1-23-11-15-25(16-12-23)7-5-19-30-21-27-9-4-10-28(29(27)3)22-31-20-6-8-26-17-13-24(2)14-18-26/h4,9-18H,19-22H2,1-3H3/q+1 |
| InChIKey | YTSAZXIMKZVEEQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium?
The IUPAC name of 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium (CID 71605375) is 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium.
What is the SMILES notation for 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium?
The canonical SMILES for 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium is Cc1ccc(C#CCOCc2cccc(COCC#Cc3ccc(C)cc3)[n+]2C)cc1.
What is the InChIKey of 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium?
The InChIKey is YTSAZXIMKZVEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28NO2/c1-23-11-15-25(16-12-23)7-5-19-30-21-27-9-4-10-28(29(27)3)22-31-20-6-8-26-17-13-24(2)14-18-26/h4,9-18H,19-22H2,1-3H3/q+1.
What are the key properties of 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium?
1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium has a molecular weight of 410.54 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,6-bis[3-(4-methylphenyl)prop-2-ynoxymethyl]pyridin-1-ium is sourced from PubChem (CID 71605375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).