C19H22N2O4 — CID 71605633
ethyl (2S)-2-[2-(4-nitrophenyl)-4,5,6,7-tetrahydroindol-1-yl]propanoate (PubChem CID 71605633) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl (2S)-2-[2-(4-nitrophenyl)-4,5,6,7-tetrahydroindol-1-yl]propanoate.
| Compound Name | ethyl (2S)-2-[2-(4-nitrophenyl)-4,5,6,7-tetrahydroindol-1-yl]propanoate |
|---|---|
| PubChem CID | 71605633 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl (2S)-2-[2-(4-nitrophenyl)-4,5,6,7-tetrahydroindol-1-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)n1c(-c2ccc([N+](=O)[O-])cc2)cc2c1CCCC2 |
| InChI | InChI=1S/C19H22N2O4/c1-3-25-19(22)13(2)20-17-7-5-4-6-15(17)12-18(20)14-8-10-16(11-9-14)21(23)24/h8-13H,3-7H2,1-2H3/t13-/m0/s1 |
| InChIKey | JAXFNTVBJBQDOO-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|