About 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium
1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium (PubChem CID 71605714) has the molecular formula C20H20NO2+
and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium |
| PubChem CID | 71605714 |
| Molecular Formula | C20H20NO2+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium |
| SMILES | C[n+]1c(COc2ccccc2)cccc1COc1ccccc1 |
| InChI | InChI=1S/C20H20NO2/c1-21-17(15-22-19-11-4-2-5-12-19)9-8-10-18(21)16-23-20-13-6-3-7-14-20/h2-14H,15-16H2,1H3/q+1 |
| InChIKey | WRUVHZFRRXADMC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium?
The IUPAC name of 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium (CID 71605714) is 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium.
What is the SMILES notation for 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium?
The canonical SMILES for 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium is C[n+]1c(COc2ccccc2)cccc1COc1ccccc1.
What is the InChIKey of 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium?
The InChIKey is WRUVHZFRRXADMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20NO2/c1-21-17(15-22-19-11-4-2-5-12-19)9-8-10-18(21)16-23-20-13-6-3-7-14-20/h2-14H,15-16H2,1H3/q+1.
What are the key properties of 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium?
1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium has a molecular weight of 306.39 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,6-bis(phenoxymethyl)pyridin-1-ium is sourced from PubChem (CID 71605714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).