C20H24N3O8P — CID 71605832
methyl (2S,4S)-4-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-dimethoxyphosphorylpyrrolidine-1-carboxylate (PubChem CID 71605832) has the molecular formula C20H24N3O8P and a molecular weight of 465.40 g/mol. Its IUPAC name is methyl (2S,4S)-4-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-dimethoxyphosphorylpyrrolidine-1-carboxylate.
| Compound Name | methyl (2S,4S)-4-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-dimethoxyphosphorylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71605832 |
| Molecular Formula | C20H24N3O8P |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | methyl (2S,4S)-4-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-dimethoxyphosphorylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](n2cc(C)c(=O)n(C(=O)c3ccccc3)c2=O)C[C@@H]1P(=O)(OC)OC |
| InChI | InChI=1S/C20H24N3O8P/c1-13-11-21(19(26)23(17(13)24)18(25)14-8-6-5-7-9-14)15-10-16(32(28,30-3)31-4)22(12-15)20(27)29-2/h5-9,11,15-16H,10,12H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | WWHDLSCPQAWTBI-HOTGVXAUSA-N |
| XLogP | 1.83 |
| TPSA | 126.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|