About [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol
[(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol (PubChem CID 71605960) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol |
| PubChem CID | 71605960 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol |
| SMILES | C=C(C)[C@@H]1CCC(CO)=C[C@H]1C(OCC)OCC |
| InChI | InChI=1S/C15H26O3/c1-5-17-15(18-6-2)14-9-12(10-16)7-8-13(14)11(3)4/h9,13-16H,3,5-8,10H2,1-2,4H3/t13-,14+/m0/s1 |
| InChIKey | BBLOKGUVXZVNMW-UONOGXRCSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol?
The IUPAC name of [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol (CID 71605960) is [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol.
What is the SMILES notation for [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol?
The canonical SMILES for [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol is C=C(C)[C@@H]1CCC(CO)=C[C@H]1C(OCC)OCC.
What is the InChIKey of [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol?
The InChIKey is BBLOKGUVXZVNMW-UONOGXRCSA-N. The full InChI is InChI=1S/C15H26O3/c1-5-17-15(18-6-2)14-9-12(10-16)7-8-13(14)11(3)4/h9,13-16H,3,5-8,10H2,1-2,4H3/t13-,14+/m0/s1.
What are the key properties of [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol?
[(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol has a molecular weight of 254.37 g/mol, XLogP of 2.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3-(diethoxymethyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol is sourced from PubChem (CID 71605960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).