C21H20N2O2 — CID 71606116
1-benzyl-2-(4-nitrophenyl)-4,5,6,7-tetrahydroindole (PubChem CID 71606116) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-benzyl-2-(4-nitrophenyl)-4,5,6,7-tetrahydroindole.
| Compound Name | 1-benzyl-2-(4-nitrophenyl)-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 71606116 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-benzyl-2-(4-nitrophenyl)-4,5,6,7-tetrahydroindole |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3c(n2Cc2ccccc2)CCCC3)cc1 |
| InChI | InChI=1S/C21H20N2O2/c24-23(25)19-12-10-17(11-13-19)21-14-18-8-4-5-9-20(18)22(21)15-16-6-2-1-3-7-16/h1-3,6-7,10-14H,4-5,8-9,15H2 |
| InChIKey | FUKWKGPEWVYYIL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|