C16H18O7 — CID 71606148
[(1S,2R,5S,6R)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl] 4-methoxybenzoate (PubChem CID 71606148) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl] 4-methoxybenzoate.
| Compound Name | [(1S,2R,5S,6R)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 71606148 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(1S,2R,5S,6R)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2CO[C@H]3[C@@H]2OC2(C)OC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C16H18O7/c1-16-20-8-12(22-16)13-14(23-16)11(7-19-13)21-15(17)9-3-5-10(18-2)6-4-9/h3-6,11-14H,7-8H2,1-2H3/t11-,12-,13+,14+,16?/m0/s1 |
| InChIKey | BWYBQZFRCQCFIE-LHMVGBATSA-N |
| XLogP | 1.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |