C30H32N4O6 — CID 71606244
methyl 4-[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 71606244) has the molecular formula C30H32N4O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is methyl 4-[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71606244 |
| Molecular Formula | C30H32N4O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | methyl 4-[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(NC(=O)CCCOc3cc4c(cc3OC)C(=O)N3CCC[C@H]3C=N4)cc2)cn1C |
| InChI | InChI=1S/C30H32N4O6/c1-33-18-20(14-25(33)30(37)39-3)19-8-10-21(11-9-19)32-28(35)7-5-13-40-27-16-24-23(15-26(27)38-2)29(36)34-12-4-6-22(34)17-31-24/h8-11,14-18,22H,4-7,12-13H2,1-3H3,(H,32,35)/t22-/m0/s1 |
| InChIKey | CJTCYIJVISUELD-QFIPXVFZSA-N |
| XLogP | 4.61 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|