C28H36O2Si — CID 71606654
(1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-4-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 71606654) has the molecular formula C28H36O2Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-4-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-4-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 71606654 |
| Molecular Formula | C28H36O2Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-4-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CC[C@@H]1[C@H]2CC(=O)[C@H](C)[C@H]2C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36O2Si/c1-6-13-23-25-18-26(29)20(2)24(25)19-27(23)30-31(28(3,4)5,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h6-12,14-17,20,23-25,27H,1,13,18-19H2,2-5H3/t20-,23-,24-,25-,27-/m1/s1 |
| InChIKey | VOFHNPRSHWXEII-MYTFBLFYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|