C30H38O2Si — CID 71606655
(1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(prop-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 71606655) has the molecular formula C30H38O2Si and a molecular weight of 458.72 g/mol. Its IUPAC name is (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(prop-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(prop-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 71606655 |
| Molecular Formula | C30H38O2Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (1R,3aS,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1,4-bis(prop-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CC[C@@H]1[C@H]2CC(=O)[C@H](CC=C)[C@H]2C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O2Si/c1-6-14-24-27-21-29(25(15-7-2)26(27)20-28(24)31)32-33(30(3,4)5,22-16-10-8-11-17-22)23-18-12-9-13-19-23/h6-13,16-19,24-27,29H,1-2,14-15,20-21H2,3-5H3/t24-,25-,26-,27-,29-/m1/s1 |
| InChIKey | FEPCGMBRLQKLOT-QPCYKJICSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|