C16H24O2 — CID 71606813
(3'aR,4'S,6'aS)-5,5-dimethyl-4'-prop-2-enylspiro[1,3-dioxane-2,2'-3,3a,4,6a-tetrahydro-1H-pentalene] (PubChem CID 71606813) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3'aR,4'S,6'aS)-5,5-dimethyl-4'-prop-2-enylspiro[1,3-dioxane-2,2'-3,3a,4,6a-tetrahydro-1H-pentalene].
| Compound Name | (3'aR,4'S,6'aS)-5,5-dimethyl-4'-prop-2-enylspiro[1,3-dioxane-2,2'-3,3a,4,6a-tetrahydro-1H-pentalene] |
|---|---|
| PubChem CID | 71606813 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3'aR,4'S,6'aS)-5,5-dimethyl-4'-prop-2-enylspiro[1,3-dioxane-2,2'-3,3a,4,6a-tetrahydro-1H-pentalene] |
| SMILES | C=CC[C@H]1C=C[C@@H]2CC3(C[C@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C16H24O2/c1-4-5-12-6-7-13-8-16(9-14(12)13)17-10-15(2,3)11-18-16/h4,6-7,12-14H,1,5,8-11H2,2-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | BBUPYTCQKWLJKP-BFHYXJOUSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|