About 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide
5-(2,5-dioxopyrrol-1-yl)pentanehydrazide (PubChem CID 71607325) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide.
Molecular Properties
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide |
| PubChem CID | 71607325 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide |
| SMILES | NNC(=O)CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13N3O3/c10-11-7(13)3-1-2-6-12-8(14)4-5-9(12)15/h4-5H,1-3,6,10H2,(H,11,13) |
| InChIKey | HGDLVVAFLRBLKJ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide?
The IUPAC name of 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide (CID 71607325) is 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide.
What is the SMILES notation for 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide?
The canonical SMILES for 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide is NNC(=O)CCCCN1C(=O)C=CC1=O.
What is the InChIKey of 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide?
The InChIKey is HGDLVVAFLRBLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c10-11-7(13)3-1-2-6-12-8(14)4-5-9(12)15/h4-5H,1-3,6,10H2,(H,11,13).
What are the key properties of 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide?
5-(2,5-dioxopyrrol-1-yl)pentanehydrazide has a molecular weight of 211.22 g/mol, XLogP of -0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide is sourced from PubChem (CID 71607325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).