C27H27N7O2S — CID 71607522
4-[8-amino-3-[(2S)-1-but-2-ynoylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide (PubChem CID 71607522) has the molecular formula C27H27N7O2S and a molecular weight of 513.63 g/mol. Its IUPAC name is 4-[8-amino-3-[(2S)-1-but-2-ynoylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[8-amino-3-[(2S)-1-but-2-ynoylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 71607522 |
| Molecular Formula | C27H27N7O2S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 4-[8-amino-3-[(2S)-1-but-2-ynoylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC#CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(C(=O)Nc3ncc(CC)s3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C27H27N7O2S/c1-3-7-21(35)33-14-6-5-8-20(33)25-31-22(23-24(28)29-13-15-34(23)25)17-9-11-18(12-10-17)26(36)32-27-30-16-19(4-2)37-27/h9-13,15-16,20H,4-6,8,14H2,1-2H3,(H2,28,29)(H,30,32,36)/t20-/m0/s1 |
| InChIKey | UZAXVNNMFUMUPT-FQEVSTJZSA-N |
| XLogP | 4.33 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|