C40H64N3O2S2+ — CID 71607545
2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]-N,N-dihexyl-3-methyl-1,3-benzothiazol-3-ium-6-sulfonamide (PubChem CID 71607545) has the molecular formula C40H64N3O2S2+ and a molecular weight of 683.11 g/mol. Its IUPAC name is 2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]-N,N-dihexyl-3-methyl-1,3-benzothiazol-3-ium-6-sulfonamide.
| Compound Name | 2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]-N,N-dihexyl-3-methyl-1,3-benzothiazol-3-ium-6-sulfonamide |
|---|---|
| PubChem CID | 71607545 |
| Molecular Formula | C40H64N3O2S2+ |
| Molecular Weight | 683.11 g/mol |
| Exact Mass | 682.44 |
| IUPAC Name | 2-[(E)-2-[4-(dihexylamino)phenyl]ethenyl]-N,N-dihexyl-3-methyl-1,3-benzothiazol-3-ium-6-sulfonamide |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/C=C/c2sc3cc(S(=O)(=O)N(CCCCCC)CCCCCC)ccc3[n+]2C)cc1 |
| InChI | InChI=1S/C40H64N3O2S2/c1-6-10-14-18-30-42(31-19-15-11-7-2)36-25-22-35(23-26-36)24-29-40-41(5)38-28-27-37(34-39(38)46-40)47(44,45)43(32-20-16-12-8-3)33-21-17-13-9-4/h22-29,34H,6-21,30-33H2,1-5H3/q+1 |
| InChIKey | WZWNSSIKNBREIT-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.11 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|