C21H23F3N6O3S — CID 71607631
(1R,2S,3S,4S,5S)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-fluorocyclopentane-1,2,3-triol (PubChem CID 71607631) has the molecular formula C21H23F3N6O3S and a molecular weight of 496.52 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-fluorocyclopentane-1,2,3-triol.
| Compound Name | (1R,2S,3S,4S,5S)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-fluorocyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 71607631 |
| Molecular Formula | C21H23F3N6O3S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (1R,2S,3S,4S,5S)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-fluorocyclopentane-1,2,3-triol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H]3F)c2n1 |
| InChI | InChI=1S/C21H23F3N6O3S/c1-2-5-34-21-26-19(25-12-7-9(12)8-3-4-10(22)11(23)6-8)14-20(27-21)30(29-28-14)15-13(24)16(31)18(33)17(15)32/h3-4,6,9,12-13,15-18,31-33H,2,5,7H2,1H3,(H,25,26,27)/t9-,12+,13-,15+,16-,17-,18+/m0/s1 |
| InChIKey | JLYCDVDEIUIVQR-VQGFLVHSSA-N |
| XLogP | 1.95 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |