C17H27BBrNO5S — CID 71607729
2-[N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl methanesulfonate (PubChem CID 71607729) has the molecular formula C17H27BBrNO5S and a molecular weight of 448.19 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 71607729 |
| Molecular Formula | C17H27BBrNO5S |
| Molecular Weight | 448.19 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[N-(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl methanesulfonate |
| SMILES | CC1(C)OB(c2ccc(N(CCBr)CCOS(C)(=O)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C17H27BBrNO5S/c1-16(2)17(3,4)25-18(24-16)14-6-8-15(9-7-14)20(11-10-19)12-13-23-26(5,21)22/h6-9H,10-13H2,1-5H3 |
| InChIKey | UQGIHOPHNSXJAN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|