C16H24BBr2NO2 — CID 71607730
N,N-bis(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 71607730) has the molecular formula C16H24BBr2NO2 and a molecular weight of 432.99 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N,N-bis(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 71607730 |
| Molecular Formula | C16H24BBr2NO2 |
| Molecular Weight | 432.99 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N,N-bis(2-bromoethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccc(N(CCBr)CCBr)cc2)OC1(C)C |
| InChI | InChI=1S/C16H24BBr2NO2/c1-15(2)16(3,4)22-17(21-15)13-5-7-14(8-6-13)20(11-9-18)12-10-19/h5-8H,9-12H2,1-4H3 |
| InChIKey | NVFJVCTXYBLYTO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.99 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|