About 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine
4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 71608043) has the molecular formula C18H13ClN4OS
and a molecular weight of 368.85 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
| PubChem CID | 71608043 |
| Molecular Formula | C18H13ClN4OS |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccnc(Nc2nc(-c3cc(-c4ccc(Cl)cc4)no3)cs2)c1 |
| InChI | InChI=1S/C18H13ClN4OS/c1-11-6-7-20-17(8-11)22-18-21-15(10-25-18)16-9-14(23-24-16)12-2-4-13(19)5-3-12/h2-10H,1H3,(H,20,21,22) |
| InChIKey | ODOSTDOMOINNQQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine (CID 71608043) is 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine is Cc1ccnc(Nc2nc(-c3cc(-c4ccc(Cl)cc4)no3)cs2)c1.
What is the InChIKey of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine?
The InChIKey is ODOSTDOMOINNQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClN4OS/c1-11-6-7-20-17(8-11)22-18-21-15(10-25-18)16-9-14(23-24-16)12-2-4-13(19)5-3-12/h2-10H,1H3,(H,20,21,22).
What are the key properties of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine?
4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine has a molecular weight of 368.85 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-(4-methyl-2-pyridinyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 71608043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).