C28H43NO4Si — CID 71608493
(2R,3R,4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-N,N,2,4,6-pentamethylheptanamide (PubChem CID 71608493) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-N,N,2,4,6-pentamethylheptanamide.
| Compound Name | (2R,3R,4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-N,N,2,4,6-pentamethylheptanamide |
|---|---|
| PubChem CID | 71608493 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (2R,3R,4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-N,N,2,4,6-pentamethylheptanamide |
| SMILES | C[C@@H]([C@@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C28H43NO4Si/c1-20(25(30)21(2)26(31)22(3)27(32)29(7)8)19-33-34(28(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,20-22,25-26,30-31H,19H2,1-8H3/t20-,21-,22+,25-,26+/m0/s1 |
| InChIKey | NPSALSVQBKDTGR-VXOZGMPSSA-N |
| XLogP | 3.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|