C19H27N3O2S — CID 71608663
N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]-6-(methylamino)-2-propylsulfanylpyridine-3-carboxamide (PubChem CID 71608663) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]-6-(methylamino)-2-propylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]-6-(methylamino)-2-propylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71608663 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]-6-(methylamino)-2-propylsulfanylpyridine-3-carboxamide |
| SMILES | CCCSc1nc(NC)ccc1C(=O)N[C@@H]1[C@@H]2CC3C[C@@](O)(C2)C[C@H]31 |
| InChI | InChI=1S/C19H27N3O2S/c1-3-6-25-18-13(4-5-15(20-2)21-18)17(23)22-16-12-7-11-8-19(24,9-12)10-14(11)16/h4-5,11-12,14,16,24H,3,6-10H2,1-2H3,(H,20,21)(H,22,23)/t11?,12-,14-,16-,19-/m1/s1 |
| InChIKey | ARQSOFWSUWAESN-YDNRXPSNSA-N |
| XLogP | 2.90 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |