C34H65IO5Si2 — CID 71608702
(2E,4R,5R,7E,9E,13S)-1,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,7-trimethyltrideca-2,7,9-trien-5-ol (PubChem CID 71608702) has the molecular formula C34H65IO5Si2 and a molecular weight of 736.97 g/mol. Its IUPAC name is (2E,4R,5R,7E,9E,13S)-1,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,7-trimethyltrideca-2,7,9-trien-5-ol.
| Compound Name | (2E,4R,5R,7E,9E,13S)-1,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,7-trimethyltrideca-2,7,9-trien-5-ol |
|---|---|
| PubChem CID | 71608702 |
| Molecular Formula | C34H65IO5Si2 |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.34 |
| IUPAC Name | (2E,4R,5R,7E,9E,13S)-1,13-bis[[tert-butyl(dimethyl)silyl]oxy]-13-[(4S,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,7-trimethyltrideca-2,7,9-trien-5-ol |
| SMILES | C/C(=C\[C@@H](C)[C@H](O)C/C(C)=C/C=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1CI)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H65IO5Si2/c1-25(22-28(36)27(3)21-26(2)24-37-41(12,13)32(4,5)6)19-17-16-18-20-29(40-42(14,15)33(7,8)9)31-30(23-35)38-34(10,11)39-31/h16-17,19,21,27-31,36H,18,20,22-24H2,1-15H3/b17-16+,25-19+,26-21+/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | LAGPXTSEZFGDLG-MHPMPKDQSA-N |
| XLogP | 9.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|