C15H16Cl2N2O2 — CID 71608944
2,6-dichloro-N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]pyridine-3-carboxamide (PubChem CID 71608944) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2,6-dichloro-N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71608944 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2,6-dichloro-N-[(1R,2R,3R,5R)-5-hydroxy-2-tricyclo[3.3.1.03,7]nonanyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1[C@@H]2CC3C[C@@](O)(C2)C[C@H]31)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c16-11-2-1-9(13(17)18-11)14(20)19-12-8-3-7-4-15(21,5-8)6-10(7)12/h1-2,7-8,10,12,21H,3-6H2,(H,19,20)/t7?,8-,10-,12-,15-/m1/s1 |
| InChIKey | YYBUNGKIGFPKTE-VRKFFRJBSA-N |
| XLogP | 2.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|