C21H22N4O7 — CID 71609086
[(1R,2R)-1-(1,3-dimethyl-2,4-dioxopteridin-6-yl)-2-hydroxypropyl] (Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoate (PubChem CID 71609086) has the molecular formula C21H22N4O7 and a molecular weight of 442.43 g/mol. Its IUPAC name is [(1R,2R)-1-(1,3-dimethyl-2,4-dioxopteridin-6-yl)-2-hydroxypropyl] (Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoate.
| Compound Name | [(1R,2R)-1-(1,3-dimethyl-2,4-dioxopteridin-6-yl)-2-hydroxypropyl] (Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 71609086 |
| Molecular Formula | C21H22N4O7 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [(1R,2R)-1-(1,3-dimethyl-2,4-dioxopteridin-6-yl)-2-hydroxypropyl] (Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoate |
| SMILES | CO/C(=C\c1ccc(O)cc1)C(=O)O[C@H](c1cnc2c(n1)c(=O)n(C)c(=O)n2C)[C@@H](C)O |
| InChI | InChI=1S/C21H22N4O7/c1-11(26)17(32-20(29)15(31-4)9-12-5-7-13(27)8-6-12)14-10-22-18-16(23-14)19(28)25(3)21(30)24(18)2/h5-11,17,26-27H,1-4H3/b15-9-/t11-,17+/m1/s1 |
| InChIKey | RZCYCKGJVROPOI-DOCAZEPQSA-N |
| XLogP | 0.39 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|